
CAS 12611-57-3
:Samarate(1-), [[N,N′-1,2-ethanediylbis[N-[(carboxy-κO)methyl]glycinato-κN,κO]](4-)]-, hydrogen, (OC-6-21)-
Description:
Samarate(1-) is a complex chemical substance characterized by its coordination with metal ions, typically functioning as a chelating agent. It features a unique structure that includes a backbone derived from N,N′-1,2-ethanediylbis(glycine) with carboxymethyl groups, which enhances its solubility and reactivity in aqueous environments. The presence of multiple functional groups, including carboxylate and amine functionalities, allows Samarate(1-) to form stable complexes with various metal ions, making it useful in applications such as biochemistry and environmental chemistry. Its anionic form indicates that it carries a negative charge, which can influence its interactions with other molecules and ions in solution. The compound is often studied for its potential roles in metal ion transport and as a ligand in coordination chemistry. Additionally, its specific coordination properties and stability can be influenced by factors such as pH and the presence of competing ligands in the environment. Overall, Samarate(1-) is a versatile compound with significant implications in both research and practical applications.
Formula:C10H12N2O8Sm·H
InChI:InChI=1S/C10H16N2O8.Sm/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);/q;+3/p-3
InChI key:InChIKey=CPFWKQAYWFSNFQ-UHFFFAOYSA-K
SMILES:O=C1[O-][Sm+3]2345[N](CC(=O)[O-]2)(CC(=O)[O-]3)CC[N]4(CC(=O)[O-]5)C1.[H+]
Synonyms:- Hydrogen [(ethylenedinitrilo)tetraacetato]samarate(III)
- Samarate(1-), [[N,N′-1,2-ethanediylbis[N-(carboxymethyl)glycinato]](4-)-N,N′,O,O′,ON,ON′]-, hydrogen, (OC-6-21)-
- Samarate(1-), [[N,N′-1,2-ethanediylbis[N-[(carboxy-κO)methyl]glycinato-κN,κO]](4-)]-, hydrogen, (OC-6-21)-
- Samarium EDTA
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Samarate(1-), [[N,N'-1,2-ethanediylbis[N-[(carboxy-κO)methyl]glycinato-κN,κO]](4-)]-, hydrogen, (OC-6-21)- (9CI)
CAS:Formula:C10H12N2O8SmMolecular weight:439.5788
