CymitQuimica logo

CAS 1261105-33-2

:

Methyl 2-(2-aminoacetyl)benzoate

Description:
Methyl 2-(2-aminoacetyl)benzoate, identified by its CAS number 1261105-33-2, is an organic compound characterized by its ester functional group and an aminoacetyl substituent on the aromatic ring. This compound features a methyl ester derived from benzoic acid, with an amino group that contributes to its potential biological activity. It typically appears as a white to off-white solid or crystalline substance. The presence of the aminoacetyl group suggests that it may participate in various chemical reactions, including acylation and amide formation, making it of interest in medicinal chemistry and organic synthesis. Its solubility is generally influenced by the ester and amino groups, which can enhance its interaction with polar solvents. Additionally, the compound may exhibit specific pharmacological properties, although detailed studies would be necessary to elucidate its biological effects and potential applications. As with many organic compounds, safety data should be consulted to understand its handling and toxicity.
Formula:C10H11NO3
InChI:InChI=1S/C10H11NO3/c1-14-10(13)8-5-3-2-4-7(8)9(12)6-11/h2-5H,6,11H2,1H3
InChI key:InChIKey=KZDIASNYERXKDL-UHFFFAOYSA-N
SMILES:C(CN)(=O)C1=C(C(OC)=O)C=CC=C1
Synonyms:
  • Methyl 2-(2-aminoacetyl)benzoate
  • Benzoic acid, 2-(2-aminoacetyl)-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.