CymitQuimica logo

CAS 1261169-72-5

:

(2,3-Difluoro-4-hydroxyphenyl)boronicacid

Description:
(2,3-Difluoro-4-hydroxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that has two fluorine substituents and a hydroxyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of fluorine atoms can enhance the compound's lipophilicity and influence its reactivity, while the hydroxyl group contributes to its acidity and potential for hydrogen bonding. The compound's structure allows it to participate in Suzuki-Miyaura cross-coupling reactions, which are valuable in the formation of carbon-carbon bonds. Additionally, the unique electronic properties imparted by the fluorine atoms may affect its biological activity and interactions with other molecules. Overall, (2,3-Difluoro-4-hydroxyphenyl)boronic acid is a versatile compound with significant implications in both research and industrial applications.
Formula:C6H5BF2O3
InChI:InChI=1S/C6H5BF2O3/c8-5-3(7(11)12)1-2-4(10)6(5)9/h1-2,10-12H
InChI key:GKKFIHYGEYECQH-UHFFFAOYSA-N
SMILES:c1cc(c(c(c1B(O)O)F)F)O
Synonyms:
  • 2,3-Difluoro-4-Hydroxyphenylboronic Acid
Found 4 products.