CymitQuimica logo

CAS 126120-73-8

:

4-(4-Methoxyphenyl)-1-methyl-4-piperidinol

Description:
4-(4-Methoxyphenyl)-1-methyl-4-piperidinol, identified by its CAS number 126120-73-8, is an organic compound characterized by its piperidine structure, which includes a methoxyphenyl group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in organic solvents, reflecting its lipophilic nature. The presence of the methoxy group enhances its hydrophobic properties, while the piperidinol moiety contributes to its potential biological activity. It may interact with various biological targets, making it of interest in medicinal chemistry and pharmacology. The compound's molecular structure suggests it could exhibit properties such as analgesic or anti-inflammatory effects, although specific biological activities would depend on further empirical studies. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards in laboratory settings.
Formula:C13H19NO2
InChI:InChI=1S/C13H19NO2/c1-14-9-7-13(15,8-10-14)11-3-5-12(16-2)6-4-11/h3-6,15H,7-10H2,1-2H3
InChI key:InChIKey=GCSXGKPZMCKCKJ-UHFFFAOYSA-N
SMILES:OC1(C2=CC=C(OC)C=C2)CCN(C)CC1
Synonyms:
  • 4-Piperidinol, 4-(4-methoxyphenyl)-1-methyl-
  • 4-(4-Methoxyphenyl)-1-methyl-4-piperidinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.