CAS 126120-85-2
:2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid
Description:
2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid is an organic compound characterized by its unique structure, which includes a benzodioxole moiety and two fluorine atoms attached to the aromatic ring. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of fluorine atoms typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. The benzodioxole structure is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the fluorine substituents. Its CAS number, 126120-85-2, allows for easy identification in chemical databases. Overall, 2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid is a compound of interest in various fields, including organic synthesis and drug development, due to its distinctive chemical characteristics and potential applications.
Formula:C8H4F2O4
InChI:InChI=1/C8H4F2O4/c9-8(10)13-5-3-1-2-4(7(11)12)6(5)14-8/h1-3H,(H,11,12)
SMILES:c1cc(c2c(c1)OC(F)(F)O2)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C8H4F2O4Purity:97%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:202.111,3-Benzodioxole-4-carboxylic acid, 2,2-difluoro-
CAS:Formula:C8H4F2O4Purity:97%Color and Shape:SolidMolecular weight:202.11182,2-Difluoro-1,3-benzodioxole-4-carboxylic acid
CAS:2,2-Difluoro-1,3-benzodioxole-4-carboxylic acidFormula:C8H4F2O4Purity:98%Color and Shape:SolidMolecular weight:202.11g/mol2,3-(Difluoromethylenedioxy)benzoic acid
CAS:Formula:C8H4F2O4Color and Shape:NeatMolecular weight:202.112,2-Difluoro-1,3-benzodioxole-4-carboxylic acid
CAS:Applications 2,2-Difluoro-1,3-benzodioxole-4-carboxylic acid
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C8H4F2O4Color and Shape:NeatMolecular weight:202.112,2-Difluoro-1,3-benzodioxole-4-carboxylic acid
CAS:Formula:C8H4F2O4Purity:97%Color and Shape:SolidMolecular weight:202.113





