CAS 1261229-48-4

2-Piperidinecarboxylic acid, 1-[(2-fluorophenyl)methyl]-, (2-fluorophenyl)methyl ester

Description:

2-Piperidinecarboxylic acid, 1-[(2-fluorophenyl)methyl]-, (2-fluorophenyl)methyl ester, identified by CAS number 1261229-48-4, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a carboxylic acid functional group and an ester linkage, indicating it can participate in various chemical reactions, including hydrolysis and esterification. The presence of a fluorophenyl group suggests that it may exhibit unique electronic properties, potentially influencing its reactivity and biological activity. The fluorine atom can enhance lipophilicity and may affect the compound's pharmacokinetics if it is considered for medicinal applications. Additionally, the compound's structure implies potential applications in organic synthesis and drug development, particularly in the design of pharmaceuticals targeting specific biological pathways. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used in experiments or applications. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and material science.

Formula: C₂₀H₂₁F₂NO₂

InChI: InChI=1S/C20H21F2NO2/c21-17-9-3-1-7-15(17)13-23-12-6-5-11-19(23)20(24)25-14-16-8-2-4-10-18(16)22/h1-4,7-10,19H,5-6,11-14H2

InChI key: InChIKey=SIVUFRMHSLSRPC-UHFFFAOYSA-N

SMILES: C(N1C(C(OCC2=C(F)C=CC=C2)=O)CCCC1)C3=C(F)C=CC=C3

Synonyms:

• 1-(2-Fluoro-benzyl)-piperidine-2-carboxylic acid 2-fluoro-benzyl ester
• (2-Fluorophenyl)methyl 1-[(2-fluorophenyl)methyl]piperidine-2-carboxylate
• 2-Piperidinecarboxylic acid, 1-[(2-fluorophenyl)methyl]-, (2-fluorophenyl)methyl ester