
CAS 1261229-64-4
:3-Piperidinemethanamine, N-[(2-chloro-5-thiazolyl)methyl]-, hydrochloride (1:1)
Description:
3-Piperidinemethanamine, N-[(2-chloro-5-thiazolyl)methyl]-, hydrochloride (1:1), with CAS number 1261229-64-4, is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential as a pharmacological agent. The presence of the thiazole moiety, specifically the 2-chloro-5-thiazolyl group, suggests that this compound may exhibit biological activity, possibly as an antimicrobial or anticancer agent, due to the known properties of thiazole derivatives. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for pharmaceutical applications. The compound's molecular structure indicates it may participate in various chemical reactions, including nucleophilic substitutions and interactions with biological targets. Its characteristics, such as melting point, solubility, and stability, would be influenced by the specific functional groups present and the hydrochloride form. Overall, this compound represents a class of substances that may have significant implications in medicinal chemistry and drug development.
Formula:C10H16ClN3S.ClH
InChI:InChI=1S/C10H16ClN3S.ClH/c11-10-14-7-9(15-10)6-13-5-8-2-1-3-12-4-8;/h7-8,12-13H,1-6H2;1H
InChI key:InChIKey=SFJVVZMGWQLBMA-UHFFFAOYSA-N
SMILES:C(NCC1CCCNC1)C=2SC(Cl)=NC2.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.