CAS 1261229-66-6: 1-(1,1-Dimethylethyl) 4-(5-chloro-2-pyrimidinyl)-1,3-piperazinedicarboxylate
Description:1-(1,1-Dimethylethyl) 4-(5-chloro-2-pyrimidinyl)-1,3-piperazinedicarboxylate is a chemical compound characterized by its complex structure, which includes a piperazine ring substituted with both a tert-butyl group and a chloro-pyrimidine moiety. This compound typically exhibits properties associated with piperazine derivatives, such as potential biological activity, which may include effects on neurotransmitter systems or other pharmacological targets. The presence of the chloro group and the pyrimidine ring suggests possible applications in medicinal chemistry, particularly in the development of pharmaceuticals. The diester functional groups in the piperazine structure may influence its solubility and reactivity, making it a candidate for further investigation in drug design. Additionally, the compound's molecular weight, melting point, and solubility characteristics would be relevant for practical applications, including formulation and synthesis. As with many synthetic organic compounds, safety data and handling precautions are essential for laboratory work involving this substance.
Formula:C14H19ClN4O4
InChI:InChI=1S/C14H19ClN4O4/c1-14(2,3)23-13(22)18-4-5-19(10(8-18)11(20)21)12-16-6-9(15)7-17-12/h6-7,10H,4-5,8H2,1-3H3,(H,20,21)
InChI key:InChIKey=OGEHQOJHDWSXAQ-UHFFFAOYSA-N
SMILES:O=C(OC(C)(C)C)N1CCN(C2=NC=C(Cl)C=N2)C(C(=O)O)C1
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 4-(5-Chloro-pyrimidin-2-yl)-piperazine-1,3-dicarboxylic acid 1-tert-butyl ester REF: 10-F089420CAS: 1261229-66-6 | - - - | - - - | Discontinued product |
![]() | 4-(5-Chloro-pyrimidin-2-yl)-piperazine-1,3-dicarboxylic acid 1-tert-butyl ester REF: 3D-LAC22966CAS: 1261229-66-6 | Min. 95% | - - - | Discontinued product |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
4-(5-Chloro-pyrimidin-2-yl)-piperazine-1,3-dicarboxylic acid 1-tert-butyl ester
Ref: 10-F089420
500mg | Discontinued | Request information |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
4-(5-Chloro-pyrimidin-2-yl)-piperazine-1,3-dicarboxylic acid 1-tert-butyl ester
Ref: 3D-LAC22966
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |