CAS 1261229-69-9

4-Piperidinemethanamine, N-[(2,4-dichlorophenyl)methyl]-, hydrochloride (1:1)

Description:

4-Piperidinemethanamine, N-[(2,4-dichlorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential as a pharmacological agent. The presence of the 2,4-dichlorophenyl group enhances its lipophilicity, potentially influencing its ability to cross biological membranes. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including medicinal chemistry. This compound may exhibit biological activity, possibly interacting with neurotransmitter systems, making it of interest in drug development. Its molecular structure suggests potential for use in the synthesis of other compounds or as a lead compound in the search for new therapeutic agents. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, the characteristics of this compound make it a subject of interest in both research and pharmaceutical contexts.

Formula: C₁₃H₁₈Cl₂N₂·ClH

InChI: InChI=1S/C13H18Cl2N2.ClH/c14-12-2-1-11(13(15)7-12)9-17-8-10-3-5-16-6-4-10;/h1-2,7,10,16-17H,3-6,8-9H2;1H

InChI key: InChIKey=MRVWQWZRKOZQPJ-UHFFFAOYSA-N

SMILES: C(NCC1CCNCC1)C2=C(Cl)C=C(Cl)C=C2.Cl

Synonyms:

• 4-Piperidinemethanamine, N-[(2,4-dichlorophenyl)methyl]-, hydrochloride (1:1)