CAS 1261229-71-3

3-Piperidinamine, 1-[(4-fluorophenyl)methyl]-N-methyl-, hydrochloride (1:1)

Description:

3-Piperidinamine, 1-[(4-fluorophenyl)methyl]-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 4-fluorobenzyl group indicates that it has a fluorine substituent on the phenyl ring, contributing to its potential biological activity and lipophilicity. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in drug synthesis or having specific pharmacological effects, although detailed biological activity would require further investigation. Its molecular structure suggests it could interact with various biological targets, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.

Formula: C₁₃H₁₉FN₂·ClH

InChI: InChI=1S/C13H19FN2.ClH/c1-15-13-3-2-8-16(10-13)9-11-4-6-12(14)7-5-11;/h4-7,13,15H,2-3,8-10H2,1H3;1H

InChI key: InChIKey=ZBDGYGZXTVFGEH-UHFFFAOYSA-N

SMILES: C(N1CC(NC)CCC1)C2=CC=C(F)C=C2.Cl

Synonyms:

• 3-Piperidinamine, 1-[(4-fluorophenyl)methyl]-N-methyl-, hydrochloride (1:1)