CAS 1261229-77-9

1-(3-Chloro-2-quinoxalinyl)-2-piperidinemethanol

Description:

1-(3-Chloro-2-quinoxalinyl)-2-piperidinemethanol is a chemical compound characterized by its unique structure, which includes a quinoxaline moiety and a piperidine ring. The presence of the chloro group at the 3-position of the quinoxaline contributes to its reactivity and potential biological activity. This compound is typically classified as an organic heterocyclic compound due to the incorporation of nitrogen atoms in its ring structures. It may exhibit properties such as solubility in organic solvents, and its molecular interactions can be influenced by the hydroxymethyl group attached to the piperidine. The compound's potential applications could span various fields, including medicinal chemistry, where it may serve as a lead compound for drug development, particularly in targeting specific biological pathways. Its synthesis and characterization would involve standard organic chemistry techniques, and its biological activity would need to be evaluated through appropriate pharmacological studies. As with many chemical substances, safety data and handling precautions are essential for laboratory work involving this compound.

Formula: C₁₄H₁₆ClN₃O

InChI: InChI=1S/C14H16ClN3O/c15-13-14(18-8-4-3-5-10(18)9-19)17-12-7-2-1-6-11(12)16-13/h1-2,6-7,10,19H,3-5,8-9H2

InChI key: InChIKey=URBYMFREPFMEFU-UHFFFAOYSA-N

SMILES: ClC=1C(=NC2=C(N1)C=CC=C2)N3C(CO)CCCC3

Synonyms:

• 2-Piperidinemethanol, 1-(3-chloro-2-quinoxalinyl)-
• 1-(3-Chloro-2-quinoxalinyl)-2-piperidinemethanol