CAS 1261229-87-1

1-(4-Chloro-5-methyl-2-pyrimidinyl)-2-piperidinecarboxylic acid

Description:

1-(4-Chloro-5-methyl-2-pyrimidinyl)-2-piperidinecarboxylic acid is a chemical compound characterized by its unique structural features, which include a pyrimidine ring substituted with a chlorine atom and a methyl group, as well as a piperidine moiety. This compound is typically classified as a heterocyclic organic compound due to the presence of nitrogen atoms in its ring structures. The carboxylic acid functional group contributes to its acidity and potential reactivity, making it of interest in various chemical applications, including medicinal chemistry. The presence of the chloro and methyl substituents can influence the compound's biological activity, solubility, and overall pharmacokinetic properties. Additionally, the compound may exhibit specific interactions with biological targets, which can be explored for therapeutic purposes. Its CAS number, 1261229-87-1, serves as a unique identifier for regulatory and research purposes, facilitating the study and application of this compound in scientific literature and databases.

Formula: C₁₁H₁₄ClN₃O₂

InChI: InChI=1S/C11H14ClN3O2/c1-7-6-13-11(14-9(7)12)15-5-3-2-4-8(15)10(16)17/h6,8H,2-5H2,1H3,(H,16,17)

InChI key: InChIKey=UITHREIUENPVIT-UHFFFAOYSA-N

SMILES: C(O)(=O)C1N(CCCC1)C=2N=C(Cl)C(C)=CN2

Synonyms:

• 2-Piperidinecarboxylic acid, 1-(4-chloro-5-methyl-2-pyrimidinyl)-
• 1-(4-Chloro-5-methyl-2-pyrimidinyl)-2-piperidinecarboxylic acid