CAS 1261229-91-7
:1,1-Dimethylethyl 2-[[[6-chloro-2-(methylthio)-4-pyrimidinyl]amino]methyl]-1-pyrrolidinecarboxylate
Description:
1,1-Dimethylethyl 2-[[[6-chloro-2-(methylthio)-4-pyrimidinyl]amino]methyl]-1-pyrrolidinecarboxylate, identified by its CAS number 1261229-91-7, is a chemical compound characterized by its complex structure, which includes a pyrimidine ring and a pyrrolidine moiety. This compound features a chloro substituent and a methylthio group, contributing to its unique reactivity and potential biological activity. The presence of the dimethylethyl group suggests steric hindrance, which may influence its interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, particularly in the context of medicinal chemistry, where they may exhibit activity against specific enzymes or receptors. The molecular structure indicates potential for hydrogen bonding and other intermolecular interactions, which are crucial for its biological efficacy. As with many synthetic organic compounds, understanding its solubility, stability, and reactivity under various conditions is essential for its application in research and development.
Formula:C15H23ClN4O2S
InChI:InChI=1S/C15H23ClN4O2S/c1-15(2,3)22-14(21)20-7-5-6-10(20)9-17-12-8-11(16)18-13(19-12)23-4/h8,10H,5-7,9H2,1-4H3,(H,17,18,19)
InChI key:InChIKey=ZHLFISQLYRRURH-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C(CNC2=NC(SC)=NC(Cl)=C2)CCC1
Synonyms:- 1,1-Dimethylethyl 2-[[[6-chloro-2-(methylthio)-4-pyrimidinyl]amino]methyl]-1-pyrrolidinecarboxylate
- 1-Pyrrolidinecarboxylic acid, 2-[[[6-chloro-2-(methylthio)-4-pyrimidinyl]amino]methyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.