CAS 1261229-94-0
:1,1-Dimethylethyl 2-[[(4,6-dimethyl-2-pyrimidinyl)oxy]methyl]-1-pyrrolidinecarboxylate
Description:
1,1-Dimethylethyl 2-[[(4,6-dimethyl-2-pyrimidinyl)oxy]methyl]-1-pyrrolidinecarboxylate, with the CAS number 1261229-94-0, is a chemical compound characterized by its complex structure, which includes a pyrrolidine ring and a pyrimidine moiety. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, potentially influencing its reactivity and solubility. The presence of the pyrimidine ring suggests potential biological activity, as pyrimidines are often found in pharmaceuticals and agrochemicals. The ether linkage (–O–) in the structure may enhance its stability and solubility in organic solvents. Additionally, the carboxylate functional group indicates that it may participate in various chemical reactions, such as esterification or amidation. Overall, this compound's unique structural features may confer specific properties that could be of interest in medicinal chemistry or material science, although detailed studies would be necessary to fully elucidate its characteristics and potential applications.
Formula:C16H25N3O3
InChI:InChI=1S/C16H25N3O3/c1-11-9-12(2)18-14(17-11)21-10-13-7-6-8-19(13)15(20)22-16(3,4)5/h9,13H,6-8,10H2,1-5H3
InChI key:InChIKey=HBZCLBJTPUCRPH-UHFFFAOYSA-N
SMILES:C(OC=1N=C(C)C=C(C)N1)C2N(C(OC(C)(C)C)=O)CCC2
Synonyms:- 1-Pyrrolidinecarboxylic acid, 2-[[(4,6-dimethyl-2-pyrimidinyl)oxy]methyl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 2-[[(4,6-dimethyl-2-pyrimidinyl)oxy]methyl]-1-pyrrolidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.