CAS 1261230-26-5

2-Piperidinemethanamine, 1-(5-thiazolylmethyl)-, hydrochloride (1:1)

Description:

2-Piperidinemethanamine, 1-(5-thiazolylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine and thiazole moieties, which contribute to its biological activity. The piperidine ring provides a basic nitrogen atom, making the compound a potential amine, while the thiazole group introduces heteroatoms that can participate in various chemical interactions. As a hydrochloride salt, it is typically more soluble in water than its free base form, enhancing its bioavailability for pharmaceutical applications. This compound may exhibit properties such as being a potential ligand for biological targets, and its structure suggests possible uses in medicinal chemistry, particularly in the development of therapeutics. The presence of both the piperidine and thiazole structures may also indicate potential activity in central nervous system modulation or other pharmacological effects. However, specific biological activities and safety profiles would require further investigation through empirical studies.

Formula: C₁₀H₁₇N₃S·ClH

InChI: InChI=1S/C10H17N3S.ClH/c11-5-9-3-1-2-4-13(9)7-10-6-12-8-14-10;/h6,8-9H,1-5,7,11H2;1H

InChI key: InChIKey=WDTPCTBENKDLDR-UHFFFAOYSA-N

SMILES: C(N1C(CN)CCCC1)C2=CN=CS2.Cl

Synonyms:

• 2-Piperidinemethanamine, 1-(5-thiazolylmethyl)-, hydrochloride (1:1)