CymitQuimica logo

CAS 1261230-31-2

:

1-(4-Chloro-5-methyl-2-pyrimidinyl)-3-piperidinemethanol

Description:
1-(4-Chloro-5-methyl-2-pyrimidinyl)-3-piperidinemethanol is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a chlorine atom and a methyl group, as well as a piperidine moiety linked to a hydroxymethyl group. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the hydroxyl group, while its aromatic and heterocyclic components may contribute to its biological activity. The presence of the chlorine atom can influence its reactivity and interaction with biological targets, potentially enhancing its pharmacological properties. Additionally, the piperidine ring may impart basic characteristics, allowing for interactions with various receptors or enzymes. Overall, this compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its specific applications and efficacy would depend on further studies and evaluations in biological systems.
Formula:C11H16ClN3O
InChI:InChI=1S/C11H16ClN3O/c1-8-5-13-11(14-10(8)12)15-4-2-3-9(6-15)7-16/h5,9,16H,2-4,6-7H2,1H3
InChI key:InChIKey=FUDYBKAUMORSNG-UHFFFAOYSA-N
SMILES:ClC1=NC(=NC=C1C)N2CC(CO)CCC2
Synonyms:
  • 1-(4-Chloro-5-methyl-2-pyrimidinyl)-3-piperidinemethanol
  • 3-Piperidinemethanol, 1-(4-chloro-5-methyl-2-pyrimidinyl)-
  • [1-(4-Chloro-5-methyl-pyrimidin-2-yl)-piperidin-3-yl]-methanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.