CAS 1261230-45-8

2-Pyrrolidinemethanamine, N-[(2,6-dichlorophenyl)methyl]-, hydrochloride (1:1)

Description:

2-Pyrrolidinemethanamine, N-[(2,6-dichlorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine and amine functional groups, which contribute to its potential biological activity. The presence of the 2,6-dichlorophenyl moiety suggests that it may exhibit significant lipophilicity, influencing its interaction with biological membranes and receptors. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may be of interest in medicinal chemistry, particularly in the development of therapeutic agents, due to its structural features that could interact with various biological targets. Additionally, the presence of chlorine substituents may affect its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion (ADME). Safety and handling precautions should be observed, as with any chemical substance, particularly those with potential biological activity. Further studies would be necessary to elucidate its specific mechanisms of action and therapeutic potential.

Formula: C₁₂H₁₆Cl₂N₂·ClH

InChI: InChI=1S/C12H16Cl2N2.ClH/c13-11-4-1-5-12(14)10(11)8-15-7-9-3-2-6-16-9;/h1,4-5,9,15-16H,2-3,6-8H2;1H

InChI key: InChIKey=FQQSIRLKINXTEX-UHFFFAOYSA-N

SMILES: C(NCC1CCCN1)C2=C(Cl)C=CC=C2Cl.Cl

Synonyms:

• 2-Pyrrolidinemethanamine, N-[(2,6-dichlorophenyl)methyl]-, hydrochloride (1:1)