
CAS 1261230-57-2
:4-Piperidinamine, N-[(3,4-dichlorophenyl)methyl]-N-methyl-, hydrochloride (1:1)
Description:
4-Piperidinamine, N-[(3,4-dichlorophenyl)methyl]-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered ring containing one nitrogen atom. This substance features a dichlorophenyl group, indicating the presence of two chlorine atoms on a phenyl ring, which contributes to its biological activity and potential pharmacological properties. The compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications, particularly in medicinal chemistry. Its structure suggests potential interactions with biological targets, making it of interest in drug development. The presence of the piperidine and dichlorophenyl moieties may influence its lipophilicity, receptor binding, and overall pharmacokinetics. As with many piperidine derivatives, it may exhibit a range of biological activities, including effects on the central nervous system or other therapeutic areas. Safety and handling precautions should be observed due to its chemical nature and potential biological effects.
Formula:C13H18Cl2N2·ClH
InChI:InChI=1S/C13H18Cl2N2.ClH/c1-17(11-4-6-16-7-5-11)9-10-2-3-12(14)13(15)8-10;/h2-3,8,11,16H,4-7,9H2,1H3;1H
InChI key:InChIKey=WRIBULICOWEQMW-UHFFFAOYSA-N
SMILES:C(N(C)C1CCNCC1)C2=CC(Cl)=C(Cl)C=C2.Cl
Synonyms:- 4-Piperidinamine, N-[(3,4-dichlorophenyl)methyl]-N-methyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.