CAS 1261230-58-3

trans-4-[(6-Chloro-4-pyrimidinyl)amino]cyclohexanol

Description:

Trans-4-[(6-Chloro-4-pyrimidinyl)amino]cyclohexanol is a chemical compound characterized by its unique structural features, which include a cyclohexanol ring and a pyrimidine moiety. The presence of the chloro group on the pyrimidine ring contributes to its reactivity and potential biological activity. This compound is classified as an amino alcohol, which typically exhibits properties such as solubility in polar solvents due to the hydroxyl group, and it may participate in hydrogen bonding. The trans configuration of the cyclohexanol indicates that the substituents are positioned on opposite sides of the ring, influencing its three-dimensional shape and steric interactions. Such structural characteristics can affect the compound's pharmacological properties, making it of interest in medicinal chemistry. Additionally, the presence of the chloro substituent may enhance its lipophilicity, potentially impacting its bioavailability and interaction with biological targets. Overall, trans-4-[(6-Chloro-4-pyrimidinyl)amino]cyclohexanol represents a compound with potential applications in drug development and research.

Formula: C₁₀H₁₄ClN₃O

InChI: InChI=1/C10H14ClN3O/c11-9-5-10(13-6-12-9)14-7-1-3-8(15)4-2-7/h5-8,15H,1-4H2,(H,12,13,14)/t7-,8-

InChI key: InChIKey=HBKRJPAPPJRKNE-ZKCHVHJHNA-N

SMILES: N(C=1C=C(Cl)N=CN1)[C@@H]2CC[C@@H](O)CC2

Synonyms:

• Cyclohexanol, 4-[(6-chloro-4-pyrimidinyl)amino]-, trans-
• trans-4-[(6-Chloro-4-pyrimidinyl)amino]cyclohexanol

trans-4-((6-Chloropyrimidin-4-yl)amino)cyclohexanol

CAS: 1261230-58-3

Formula: C₁₀H₁₄ClN₃O

Molecular weight: 227.6907

Ref: IN-DA000RNQ