CAS 1261230-62-9

2-Pyrrolidinemethanamine, N-[(3-chlorophenyl)methyl]-, hydrochloride (1:1)

Description:

2-Pyrrolidinemethanamine, N-[(3-chlorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its structural features, which include a pyrrolidine ring and a chlorophenyl group. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications in medicinal chemistry and pharmacology. The presence of the 3-chlorophenyl moiety suggests potential interactions with biological targets, which may contribute to its pharmacological properties. The compound's molecular structure indicates it may exhibit basic properties due to the amine group, allowing it to participate in protonation reactions. Additionally, the hydrochloride form often stabilizes the compound and improves its handling characteristics. As with many amines, it may display a range of biological activities, making it of interest in drug development. Safety and handling precautions are essential, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₁₂H₁₇ClN₂·ClH

InChI: InChI=1S/C12H17ClN2.ClH/c13-11-4-1-3-10(7-11)8-14-9-12-5-2-6-15-12;/h1,3-4,7,12,14-15H,2,5-6,8-9H2;1H

InChI key: InChIKey=HYJNISDVYSAXKL-UHFFFAOYSA-N

SMILES: C(NCC1CCCN1)C2=CC(Cl)=CC=C2.Cl

Synonyms:

• 2-Pyrrolidinemethanamine, N-[(3-chlorophenyl)methyl]-, hydrochloride (1:1)