CymitQuimica logo

CAS 1261230-69-6

:

4-Piperidinemethanamine, 1-[(3-chlorophenyl)methyl]-, hydrochloride (1:1)

Description:
4-Piperidinemethanamine, 1-[(3-chlorophenyl)methyl]-, hydrochloride (1:1), commonly referred to as a hydrochloride salt, is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential biological activity. The presence of the 3-chlorophenyl group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals. This compound may exhibit properties such as acting as a neurotransmitter modulator or having implications in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug discovery. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, this compound represents a specific class of amines with potential applications in medicinal chemistry and pharmacology.
Formula:C13H19ClN2·ClH
InChI:InChI=1S/C13H19ClN2.ClH/c14-13-3-1-2-12(8-13)10-16-6-4-11(9-15)5-7-16;/h1-3,8,11H,4-7,9-10,15H2;1H
InChI key:InChIKey=COTIOFTVIGDHKL-UHFFFAOYSA-N
SMILES:C(N1CCC(CN)CC1)C2=CC(Cl)=CC=C2.Cl
Synonyms:
  • 4-Piperidinemethanamine, 1-[(3-chlorophenyl)methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.