CAS 1261230-74-3
:(2-Fluorophenyl)methyl 1-[(2-fluorophenyl)methyl]-4-piperidinecarboxylate
Description:
The chemical substance known as (2-Fluorophenyl)methyl 1-[(2-fluorophenyl)methyl]-4-piperidinecarboxylate, with the CAS number 1261230-74-3, is a synthetic organic compound characterized by its complex structure, which includes a piperidine ring and fluorophenyl groups. This compound typically exhibits properties associated with piperidine derivatives, such as potential psychoactive effects, due to its ability to interact with neurotransmitter systems. The presence of fluorine atoms in the phenyl groups can enhance lipophilicity and influence the compound's biological activity, potentially affecting its pharmacokinetics and receptor binding affinity. Additionally, the ester functional group in the structure may contribute to its reactivity and solubility in various solvents. As with many synthetic compounds, the specific characteristics, including melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which the substance is studied. Overall, this compound may be of interest in medicinal chemistry and pharmacological research, particularly in the development of new therapeutic agents.
Formula:C20H21F2NO2
InChI:InChI=1S/C20H21F2NO2/c21-18-7-3-1-5-16(18)13-23-11-9-15(10-12-23)20(24)25-14-17-6-2-4-8-19(17)22/h1-8,15H,9-14H2
InChI key:InChIKey=PGCLVXYMXCZCRX-UHFFFAOYSA-N
SMILES:C(N1CCC(C(OCC2=C(F)C=CC=C2)=O)CC1)C3=C(F)C=CC=C3
Synonyms:- 4-Piperidinecarboxylic acid, 1-[(2-fluorophenyl)methyl]-, (2-fluorophenyl)methyl ester
- (2-Fluorophenyl)methyl 1-[(2-fluorophenyl)methyl]-4-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.