CAS 1261230-77-6

3-Pyrrolidinamine, N-[(4-fluorophenyl)methyl]-, hydrochloride (1:1)

Description:

3-Pyrrolidinamine, N-[(4-fluorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. The presence of a 4-fluorobenzyl group attached to the nitrogen atom of the pyrrolidine contributes to its unique properties, including potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. Safety and handling precautions are essential, as with any chemical substance, particularly those with biological activity. Overall, 3-Pyrrolidinamine, N-[(4-fluorophenyl)methyl]-, hydrochloride (1:1) represents a class of compounds that may have significant implications in research and development within the field of medicinal chemistry.

Formula: C₁₁H₁₅FN₂·ClH

InChI: InChI=1S/C11H15FN2.ClH/c12-10-3-1-9(2-4-10)7-14-11-5-6-13-8-11;/h1-4,11,13-14H,5-8H2;1H

InChI key: InChIKey=MNGFAORGENVUCN-UHFFFAOYSA-N

SMILES: C(NC1CCNC1)C2=CC=C(F)C=C2.Cl

Synonyms:

• 3-Pyrrolidinamine, N-[(4-fluorophenyl)methyl]-, hydrochloride (1:1)