
CAS 1261230-78-7
:4-Piperidinamine, 1-[2-(methylthio)-4-pyrimidinyl]-, hydrochloride (1:1)
Description:
4-Piperidinamine, 1-[2-(methylthio)-4-pyrimidinyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine and pyrimidine moieties, which contribute to its biological activity. The presence of the methylthio group enhances its lipophilicity, potentially influencing its pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various formulations. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its structure suggests potential interactions with biological receptors or enzymes, making it a candidate for further investigation in drug discovery. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. The compound's CAS number, 1261230-78-7, allows for precise identification in chemical databases and literature, aiding researchers in sourcing and studying its properties and applications.
Formula:C10H16N4S·ClH
InChI:InChI=1S/C10H16N4S.ClH/c1-15-10-12-5-2-9(13-10)14-6-3-8(11)4-7-14;/h2,5,8H,3-4,6-7,11H2,1H3;1H
InChI key:InChIKey=CEPPWOBUKNHKQE-UHFFFAOYSA-N
SMILES:S(C)C=1N=C(C=CN1)N2CCC(N)CC2.Cl
Synonyms:- 4-Piperidinamine, 1-[2-(methylthio)-4-pyrimidinyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.