CAS 1261230-89-0

Pyrrolidine, 2-[[(2-fluorophenyl)methoxy]methyl]-, hydrochloride (1:1)

Description:

Pyrrolidine, 2-[[(2-fluorophenyl)methoxy]methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine core, which is a five-membered saturated heterocyclic amine. The presence of a 2-fluorophenyl group and a methoxy methyl substituent contributes to its unique properties, potentially influencing its biological activity and solubility. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The compound may exhibit specific pharmacological effects, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, and the fluorine atom may enhance lipophilicity or metabolic stability. Safety and handling precautions are essential, as with any chemical substance, particularly those with potential biological activity. Overall, this compound represents a class of molecules that may have applications in drug development or as research tools in various fields of chemistry and biology.

Formula: C₁₂H₁₆FNO·ClH

InChI: InChI=1S/C12H16FNO.ClH/c13-12-6-2-1-4-10(12)8-15-9-11-5-3-7-14-11;/h1-2,4,6,11,14H,3,5,7-9H2;1H

InChI key: InChIKey=NNKAVHYZWOJECH-UHFFFAOYSA-N

SMILES: C(OCC1CCCN1)C2=C(F)C=CC=C2.Cl

Synonyms:

• Pyrrolidine, 2-[[(2-fluorophenyl)methoxy]methyl]-, hydrochloride (1:1)