CAS 1261231-03-1

1-(5-Fluoro-2-pyrimidinyl)-3-piperidinecarboxylic acid

Description:

1-(5-Fluoro-2-pyrimidinyl)-3-piperidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a fluorine atom and a piperidine ring with a carboxylic acid functional group. This compound typically exhibits properties associated with both heterocyclic and aliphatic compounds, including potential polar characteristics due to the presence of the carboxylic acid group. The fluorine substitution can influence its reactivity and biological activity, often enhancing lipophilicity and metabolic stability. The compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, as the piperidine and pyrimidine moieties are common in various bioactive molecules. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and solvent polarity. Additionally, the presence of the fluorine atom may impart unique electronic properties, making it a candidate for further research in drug design and development.

Formula: C₁₀H₁₂FN₃O₂

InChI: InChI=1S/C10H12FN3O2/c11-8-4-12-10(13-5-8)14-3-1-2-7(6-14)9(15)16/h4-5,7H,1-3,6H2,(H,15,16)

InChI key: InChIKey=ZTBLITPEVYVIAH-UHFFFAOYSA-N

SMILES: C(O)(=O)C1CN(CCC1)C=2N=CC(F)=CN2

Synonyms:

• 1-(5-Fluoro-2-pyrimidinyl)-3-piperidinecarboxylic acid
• 3-Piperidinecarboxylic acid, 1-(5-fluoro-2-pyrimidinyl)-