CAS 1261231-19-9

1-(4-Chloro-5-methyl-2-pyrimidinyl)-4-piperidinecarboxylic acid

Description:

1-(4-Chloro-5-methyl-2-pyrimidinyl)-4-piperidinecarboxylic acid is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a chlorine atom and a methyl group, as well as a piperidine ring with a carboxylic acid functional group. This compound is typically classified as a heterocyclic organic compound due to the presence of nitrogen atoms in its rings. The chlorine substituent can influence the compound's reactivity and biological activity, while the carboxylic acid group contributes to its acidity and potential for forming salts or esters. The presence of the piperidine moiety may also impart specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular interactions, solubility, and stability can vary based on environmental conditions and the presence of other functional groups. Overall, this compound may have applications in pharmaceutical research, particularly in the development of new therapeutic agents.

Formula: C₁₁H₁₄ClN₃O₂

InChI: InChI=1S/C11H14ClN3O2/c1-7-6-13-11(14-9(7)12)15-4-2-8(3-5-15)10(16)17/h6,8H,2-5H2,1H3,(H,16,17)

InChI key: InChIKey=FUPGNGVSJXKTIU-UHFFFAOYSA-N

SMILES: ClC1=NC(=NC=C1C)N2CCC(C(O)=O)CC2

Synonyms:

• 1-(4-Chloro-5-methyl-2-pyrimidinyl)-4-piperidinecarboxylic acid
• 4-Piperidinecarboxylic acid, 1-(4-chloro-5-methyl-2-pyrimidinyl)-