CAS 1261231-32-6

1,1-Dimethylethyl 3-[(4-chloro-5-methyl-2-pyrimidinyl)methylamino]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 3-[(4-chloro-5-methyl-2-pyrimidinyl)methylamino]-1-piperidinecarboxylate, with the CAS number 1261231-32-6, is a chemical compound characterized by its complex structure, which includes a piperidine ring, a pyrimidine moiety, and a tert-butyl group. This compound typically exhibits properties associated with both amines and esters, suggesting potential solubility in organic solvents and moderate stability under standard conditions. The presence of the chloro and methyl groups on the pyrimidine ring may influence its reactivity and biological activity, potentially making it a candidate for pharmaceutical applications. Its molecular structure indicates that it could interact with biological targets, possibly serving as a lead compound in drug development. Additionally, the compound's synthesis and handling would require standard laboratory safety protocols due to the presence of halogenated and nitrogen-containing groups, which can pose specific health and environmental risks. Overall, this compound represents a unique combination of functional groups that may contribute to its utility in medicinal chemistry.

Formula: C₁₆H₂₅ClN₄O₂

InChI: InChI=1S/C16H25ClN4O2/c1-11-9-18-14(19-13(11)17)20(5)12-7-6-8-21(10-12)15(22)23-16(2,3)4/h9,12H,6-8,10H2,1-5H3

InChI key: InChIKey=CMMHWJMQBSOEPB-UHFFFAOYSA-N

SMILES: N(C)(C1CN(C(OC(C)(C)C)=O)CCC1)C=2N=C(Cl)C(C)=CN2

Synonyms:

• 1-Piperidinecarboxylic acid, 3-[(4-chloro-5-methyl-2-pyrimidinyl)methylamino]-, 1,1-dimethylethyl ester
• 1,1-Dimethylethyl 3-[(4-chloro-5-methyl-2-pyrimidinyl)methylamino]-1-piperidinecarboxylate