CAS 1261231-35-9
:1,1-Dimethylethyl 3-[(2-chloro-6-methyl-4-pyrimidinyl)methylamino]-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 3-[(2-chloro-6-methyl-4-pyrimidinyl)methylamino]-1-piperidinecarboxylate, identified by its CAS number 1261231-35-9, is a chemical compound that features a complex structure incorporating a piperidine ring, a pyrimidine moiety, and a tert-butyl group. This compound is characterized by its potential biological activity, often explored in pharmaceutical research for its role as a drug candidate or intermediate. The presence of the chloro and methyl groups on the pyrimidine ring suggests possible interactions with biological targets, enhancing its pharmacological profile. Additionally, the piperidinecarboxylate structure may contribute to its solubility and stability in various environments. The compound's synthesis and characterization typically involve standard organic chemistry techniques, and its properties, such as melting point, solubility, and reactivity, would be determined through experimental methods. Overall, this compound represents a class of molecules that may exhibit significant therapeutic potential, warranting further investigation in medicinal chemistry.
Formula:C16H25ClN4O2
InChI:InChI=1S/C16H25ClN4O2/c1-11-9-13(19-14(17)18-11)20(5)12-7-6-8-21(10-12)15(22)23-16(2,3)4/h9,12H,6-8,10H2,1-5H3
InChI key:InChIKey=GPWQPSSCKYJQLP-UHFFFAOYSA-N
SMILES:N(C)(C1CN(C(OC(C)(C)C)=O)CCC1)C=2C=C(C)N=C(Cl)N2
Synonyms:- 1-Piperidinecarboxylic acid, 3-[(2-chloro-6-methyl-4-pyrimidinyl)methylamino]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 3-[(2-chloro-6-methyl-4-pyrimidinyl)methylamino]-1-piperidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.