
CAS 1261231-59-7
:3-Piperidinamine, 1-[(4-fluorophenyl)methyl]-, hydrochloride (1:1)
Description:
3-Piperidinamine, 1-[(4-fluorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 4-fluorobenzyl group indicates that the compound has a fluorine atom substituted on the phenyl ring, which can influence its biological activity and lipophilicity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in drug synthesis or possessing biological activity, possibly as a ligand for various receptors. Its molecular structure suggests it may interact with biological systems, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential pharmacological effects.
Formula:C12H17FN2·ClH
InChI:InChI=1S/C12H17FN2.ClH/c13-11-5-3-10(4-6-11)8-15-7-1-2-12(14)9-15;/h3-6,12H,1-2,7-9,14H2;1H
InChI key:InChIKey=KDHKDPZPEKDYHN-UHFFFAOYSA-N
SMILES:C(N1CC(N)CCC1)C2=CC=C(F)C=C2.Cl
Synonyms:- 3-Piperidinamine, 1-[(4-fluorophenyl)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.