CAS 1261231-60-0

4-Piperidinemethanamine, 1-(5-thiazolylmethyl)-, hydrochloride (1:1)

Description:

4-Piperidinemethanamine, 1-(5-thiazolylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine and thiazole functional groups. It typically appears as a white to off-white crystalline solid and is soluble in water, which is common for hydrochloride salts. The presence of the piperidine ring contributes to its potential as a pharmacological agent, as piperidine derivatives are often associated with various biological activities, including analgesic and anti-inflammatory effects. The thiazole moiety may enhance its interaction with biological targets, potentially influencing its pharmacokinetics and pharmacodynamics. This compound is primarily of interest in medicinal chemistry and drug development, where it may serve as a lead compound for synthesizing new therapeutic agents. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. As with any compound, further studies are necessary to fully elucidate its properties, mechanisms of action, and potential applications in various fields, including pharmaceuticals and biochemistry.

Formula: C₁₀H₁₇N₃S·ClH

InChI: InChI=1S/C10H17N3S.ClH/c11-5-9-1-3-13(4-2-9)7-10-6-12-8-14-10;/h6,8-9H,1-5,7,11H2;1H

InChI key: InChIKey=ZZTVHGQTOHYCQB-UHFFFAOYSA-N

SMILES: C(N1CCC(CN)CC1)C2=CN=CS2.Cl

Synonyms:

• 4-Piperidinemethanamine, 1-(5-thiazolylmethyl)-, hydrochloride (1:1)