CymitQuimica logo

CAS 1261231-62-2

:

4-Piperidinemethanamine, N-[(2-fluorophenyl)methyl]-, hydrochloride (1:1)

Description:
4-Piperidinemethanamine, N-[(2-fluorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential as a pharmacological agent. The presence of the 2-fluorophenyl group enhances its lipophilicity, potentially influencing its ability to cross biological membranes. As a hydrochloride salt, it is typically more soluble in water, which is advantageous for formulation in pharmaceutical applications. This compound may exhibit various biological activities, making it of interest in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions. Its molecular structure suggests potential interactions with neurotransmitter systems, although specific activity would depend on further empirical studies. Safety and handling precautions are essential, as with many amines and their derivatives, due to potential toxicity and reactivity. Overall, this compound represents a class of substances that may have significant implications in drug discovery and development.
Formula:C13H19FN2·ClH
InChI:InChI=1S/C13H19FN2.ClH/c14-13-4-2-1-3-12(13)10-16-9-11-5-7-15-8-6-11;/h1-4,11,15-16H,5-10H2;1H
InChI key:InChIKey=LJBVHRRJEAOCHK-UHFFFAOYSA-N
SMILES:C(NCC1CCNCC1)C2=C(F)C=CC=C2.Cl
Synonyms:
  • 4-Piperidinemethanamine, N-[(2-fluorophenyl)methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.