
CAS 1261231-69-9
:4-Piperidinamine, N-methyl-1-(2-thienylsulfonyl)-, hydrochloride (1:1)
Description:
4-Piperidinamine, N-methyl-1-(2-thienylsulfonyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a thienylsulfonyl group indicates that it contains a thiophene ring (a five-membered aromatic ring with sulfur) attached to a sulfonyl moiety, contributing to its potential reactivity and biological activity. The N-methyl substitution on the piperidine nitrogen enhances its lipophilicity, which may influence its pharmacokinetic properties. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including pharmaceuticals. This compound may exhibit biological activity, potentially acting as a pharmacological agent, but specific biological properties would depend on further studies. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity.
Formula:C10H16N2O2S2·ClH
InChI:InChI=1S/C10H16N2O2S2.ClH/c1-11-9-4-6-12(7-5-9)16(13,14)10-3-2-8-15-10;/h2-3,8-9,11H,4-7H2,1H3;1H
InChI key:InChIKey=MSILTOGIBPMQNG-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1CCC(NC)CC1)C2=CC=CS2.Cl
Synonyms:- 4-Piperidinamine, N-methyl-1-(2-thienylsulfonyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.