CAS 1261231-73-5

1-[(5-Bromo-2-thienyl)sulfonyl]-3-pyrrolidinol

Description:

1-[(5-Bromo-2-thienyl)sulfonyl]-3-pyrrolidinol is a chemical compound characterized by its unique structural features, which include a pyrrolidine ring and a sulfonyl group attached to a thienyl moiety. The presence of the bromine atom on the thienyl ring enhances its reactivity and may influence its biological activity. This compound is likely to exhibit polar characteristics due to the sulfonyl group, which can engage in hydrogen bonding and increase solubility in polar solvents. Additionally, the thienyl and pyrrolidine components may contribute to its potential pharmacological properties, making it of interest in medicinal chemistry. The compound's molecular structure suggests it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions, which are typical for compounds containing sulfonyl and heterocyclic groups. Overall, 1-[(5-Bromo-2-thienyl)sulfonyl]-3-pyrrolidinol represents a versatile scaffold for further chemical modifications and potential applications in drug development.

Formula: C₈H₁₀BrNO₃S₂

InChI: InChI=1S/C8H10BrNO3S2/c9-7-1-2-8(14-7)15(12,13)10-4-3-6(11)5-10/h1-2,6,11H,3-5H2

InChI key: InChIKey=NIVHRIVGCJWLPM-UHFFFAOYSA-N

SMILES: S(=O)(=O)(C=1SC(Br)=CC1)N2CC(O)CC2

Synonyms:

• 3-Pyrrolidinol, 1-[(5-bromo-2-thienyl)sulfonyl]-
• 1-[(5-Bromo-2-thienyl)sulfonyl]-3-pyrrolidinol