
CAS 1261231-74-6
:3-Piperidinamine, 1-[6-chloro-2-(methylthio)-4-pyrimidinyl]-, hydrochloride (1:1)
Description:
3-Piperidinamine, 1-[6-chloro-2-(methylthio)-4-pyrimidinyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine and pyrimidine moieties. The piperidine ring contributes to its basicity and potential for forming hydrogen bonds, while the pyrimidine ring, substituted with a chlorine atom and a methylthio group, enhances its biological activity and lipophilicity. This compound is typically encountered as a hydrochloride salt, which improves its solubility in aqueous solutions, making it suitable for pharmaceutical applications. The presence of the chlorine and methylthio groups may influence its interaction with biological targets, potentially affecting its pharmacological properties. As a hydrochloride, it is often used in research and development, particularly in the context of drug discovery, where such compounds may exhibit activity against specific biological pathways or diseases. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C10H15ClN4S·ClH
InChI:InChI=1S/C10H15ClN4S.ClH/c1-16-10-13-8(11)5-9(14-10)15-4-2-3-7(12)6-15;/h5,7H,2-4,6,12H2,1H3;1H
InChI key:InChIKey=INHPTXJPWRPWBD-UHFFFAOYSA-N
SMILES:S(C)C=1N=C(C=C(Cl)N1)N2CC(N)CCC2.Cl
Synonyms:- 3-Piperidinamine, 1-[6-chloro-2-(methylthio)-4-pyrimidinyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.