CAS 1261231-84-8
:1,1-Dimethylethyl 3-(methyl-2-pyrimidinylamino)-1-piperidinecarboxylate
Description:
1,1-Dimethylethyl 3-(methyl-2-pyrimidinylamino)-1-piperidinecarboxylate, identified by its CAS number 1261231-84-8, is a chemical compound characterized by its complex structure, which includes a piperidine ring and a pyrimidine moiety. This compound features a tert-butyl group (1,1-dimethylethyl) that contributes to its steric bulk, potentially influencing its biological activity and solubility. The presence of the methyl-2-pyrimidinylamino group suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The carboxylate functional group indicates that it may participate in various chemical reactions, including esterification and amidation. The compound's molecular structure implies that it may exhibit specific pharmacological properties, possibly acting as an inhibitor or modulator in biochemical pathways. Its solubility, stability, and reactivity would depend on the surrounding conditions, such as pH and solvent polarity. Overall, this compound's unique features make it a candidate for further investigation in drug development and related fields.
Formula:C15H24N4O2
InChI:InChI=1S/C15H24N4O2/c1-15(2,3)21-14(20)19-10-5-7-12(11-19)18(4)13-16-8-6-9-17-13/h6,8-9,12H,5,7,10-11H2,1-4H3
InChI key:InChIKey=RLUZAEZWIWEWSS-UHFFFAOYSA-N
SMILES:N(C)(C1CN(C(OC(C)(C)C)=O)CCC1)C=2N=CC=CN2
Synonyms:- 1,1-Dimethylethyl 3-(methyl-2-pyrimidinylamino)-1-piperidinecarboxylate
- 1-Piperidinecarboxylic acid, 3-(methyl-2-pyrimidinylamino)-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.