CAS 1261231-86-0

1,1-Dimethylethyl 3-[[[(5-bromo-2-thienyl)sulfonyl]amino]methyl]-1-piperidinecarboxylate

Description:

1,1-Dimethylethyl 3-[[[(5-bromo-2-thienyl)sulfonyl]amino]methyl]-1-piperidinecarboxylate, identified by its CAS number 1261231-86-0, is a chemical compound characterized by its complex structure, which includes a piperidine ring, a sulfonamide group, and a thienyl moiety. The presence of the 5-bromo-2-thienyl group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The dimethyl group contributes to the steric hindrance, which may influence the compound's reactivity and binding affinity. Additionally, the carboxylate functional group can participate in various chemical reactions, making it versatile in synthetic applications. The compound's solubility, stability, and reactivity are influenced by its functional groups, which can affect its behavior in biological systems. Overall, this compound's unique structural features position it as a candidate for further research in drug development and other chemical applications.

Formula: C₁₅H₂₃BrN₂O₄S₂

InChI: InChI=1S/C15H23BrN2O4S2/c1-15(2,3)22-14(19)18-8-4-5-11(10-18)9-17-24(20,21)13-7-6-12(16)23-13/h6-7,11,17H,4-5,8-10H2,1-3H3

InChI key: InChIKey=KKQCRZTYPIIQEZ-UHFFFAOYSA-N

SMILES: S(NCC1CN(C(OC(C)(C)C)=O)CCC1)(=O)(=O)C=2SC(Br)=CC2

Synonyms:

• 1,1-Dimethylethyl 3-[[[(5-bromo-2-thienyl)sulfonyl]amino]methyl]-1-piperidinecarboxylate
• 1-Piperidinecarboxylic acid, 3-[[[(5-bromo-2-thienyl)sulfonyl]amino]methyl]-, 1,1-dimethylethyl ester