CAS 1261231-98-4

trans-4-[[(3-Chlorophenyl)methyl]amino]cyclohexanol

Description:

Trans-4-[[(3-Chlorophenyl)methyl]amino]cyclohexanol is a chemical compound characterized by its unique structural features, including a cyclohexanol ring and a chlorophenyl group. The presence of the trans configuration indicates that specific substituents are positioned on opposite sides of the cyclohexanol ring, which can influence its spatial orientation and reactivity. The compound contains an amino group, which can participate in hydrogen bonding and may affect its solubility and interaction with biological systems. The chlorophenyl moiety introduces a halogen, which can enhance the compound's lipophilicity and potentially influence its pharmacological properties. This compound may exhibit specific biological activities, making it of interest in medicinal chemistry. Its molecular interactions, stability, and potential applications would depend on the overall conformation and electronic properties imparted by its functional groups. As with many organic compounds, its behavior in various environments, such as solvents or biological systems, would be crucial for understanding its practical applications and safety profile.

Formula: C₁₃H₁₈ClNO

InChI: InChI=1/C13H18ClNO/c14-11-3-1-2-10(8-11)9-15-12-4-6-13(16)7-5-12/h1-3,8,12-13,15-16H,4-7,9H2/t12-,13-

InChI key: InChIKey=HFNADFUHMRTDFZ-JOCQHMNTNA-N

SMILES: N(CC1=CC(Cl)=CC=C1)[C@@H]2CC[C@@H](O)CC2

Synonyms:

• trans-4-[[(3-Chlorophenyl)methyl]amino]cyclohexanol
• Cyclohexanol, 4-[[(3-chlorophenyl)methyl]amino]-, trans-