CymitQuimica logo

CAS 1261232-04-5

:

1-(3-Chloro-2-quinoxalinyl)-4-piperidinemethanol

Description:
1-(3-Chloro-2-quinoxalinyl)-4-piperidinemethanol is a chemical compound characterized by its unique structure, which includes a quinoxaline moiety and a piperidine ring. The presence of the chloro group on the quinoxaline enhances its reactivity and potential biological activity. This compound is typically classified as an organic molecule and may exhibit properties such as solubility in organic solvents, depending on the specific functional groups present. Its piperidinemethanol component suggests potential interactions with biological systems, possibly indicating pharmacological relevance. Compounds of this nature are often investigated for their roles in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or literature reference for precise values. Overall, this compound's structural features suggest it may have interesting applications in drug discovery and development.
Formula:C14H16ClN3O
InChI:InChI=1S/C14H16ClN3O/c15-13-14(18-7-5-10(9-19)6-8-18)17-12-4-2-1-3-11(12)16-13/h1-4,10,19H,5-9H2
InChI key:InChIKey=MNCCKHMZMCRIKT-UHFFFAOYSA-N
SMILES:ClC=1C(=NC2=C(N1)C=CC=C2)N3CCC(CO)CC3
Synonyms:
  • 1-(3-Chloro-2-quinoxalinyl)-4-piperidinemethanol
  • 4-Piperidinemethanol, 1-(3-chloro-2-quinoxalinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.