CAS 1261232-07-8

2-Pyrimidinamine, 4-chloro-5-methyl-N-(4-piperidinylmethyl)-, hydrochloride (1:1)

Description:

2-Pyrimidinamine, 4-chloro-5-methyl-N-(4-piperidinylmethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrimidine core, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chloro group at the 4-position and a methyl group at the 5-position contributes to its unique reactivity and potential biological activity. The N-(4-piperidinylmethyl) substituent indicates that the compound has a piperidine moiety, which is a saturated six-membered ring containing one nitrogen atom, enhancing its pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including pharmaceuticals. The compound may exhibit properties such as antimicrobial or antitumor activity, making it of interest in medicinal chemistry. Its specific interactions and mechanisms of action would depend on further studies, including in vitro and in vivo evaluations. Overall, this compound represents a class of heterocyclic amines with potential therapeutic applications.

Formula: C₁₁H₁₇ClN₄·ClH

InChI: InChI=1S/C11H17ClN4.ClH/c1-8-6-14-11(16-10(8)12)15-7-9-2-4-13-5-3-9;/h6,9,13H,2-5,7H2,1H3,(H,14,15,16);1H

InChI key: InChIKey=RILOAFWTBHGBEA-UHFFFAOYSA-N

SMILES: N(CC1CCNCC1)C=2N=C(Cl)C(C)=CN2.Cl

Synonyms:

• 2-Pyrimidinamine, 4-chloro-5-methyl-N-(4-piperidinylmethyl)-, hydrochloride (1:1)