CAS 1261232-22-7

2-Pyrrolidinemethanamine, N-[(2,5-dichlorophenyl)methyl]-, hydrochloride (1:1)

Description:

2-Pyrrolidinemethanamine, N-[(2,5-dichlorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine structure, which contributes to its cyclic amine properties. The presence of the 2,5-dichlorophenyl group indicates that it has significant aromatic characteristics, likely influencing its reactivity and interaction with biological systems. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which enhances its utility in pharmaceutical applications. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having biological activity, possibly as a ligand or in medicinal chemistry. Its specific characteristics, including melting point, boiling point, and solubility, would depend on the conditions and purity of the sample. Safety data sheets should be consulted for handling and toxicity information, as compounds with amine functionalities can be reactive and may pose health risks. Overall, this compound's unique structure suggests potential applications in various fields, including drug development and chemical research.

Formula: C₁₂H₁₆Cl₂N₂·ClH

InChI: InChI=1S/C12H16Cl2N2.ClH/c13-10-3-4-12(14)9(6-10)7-15-8-11-2-1-5-16-11;/h3-4,6,11,15-16H,1-2,5,7-8H2;1H

InChI key: InChIKey=IQULGHFISKORLR-UHFFFAOYSA-N

SMILES: C(NCC1CCCN1)C2=C(Cl)C=CC(Cl)=C2.Cl

Synonyms:

• 2-Pyrrolidinemethanamine, N-[(2,5-dichlorophenyl)methyl]-, hydrochloride (1:1)