CymitQuimica logo

CAS 1261232-23-8

:

1-(4-Chloro-5-methyl-2-pyrimidinyl)-3-pyrrolidinol

Description:
1-(4-Chloro-5-methyl-2-pyrimidinyl)-3-pyrrolidinol is a chemical compound characterized by its unique structural features, which include a pyrimidine ring substituted with a chlorine atom and a methyl group, as well as a pyrrolidine moiety. The presence of the chloro and methyl groups on the pyrimidine ring contributes to its reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound due to the inclusion of nitrogen atoms in its ring structures. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar structures often exhibit significant biological properties. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many chemical substances, safety and handling precautions are essential, particularly due to the presence of chlorine, which can pose health risks. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.
Formula:C9H12ClN3O
InChI:InChI=1S/C9H12ClN3O/c1-6-4-11-9(12-8(6)10)13-3-2-7(14)5-13/h4,7,14H,2-3,5H2,1H3
InChI key:InChIKey=UWFRFGDRORKGRX-UHFFFAOYSA-N
SMILES:ClC1=NC(=NC=C1C)N2CC(O)CC2
Synonyms:
  • 3-Pyrrolidinol, 1-(4-chloro-5-methyl-2-pyrimidinyl)-
  • 1-(4-Chloro-5-methyl-2-pyrimidinyl)-3-pyrrolidinol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.