CAS 1261232-28-3
:1,1-Dimethylethyl N-[[1-(4-methyl-2-pyrimidinyl)-4-piperidinyl]methyl]carbamate
Description:
1,1-Dimethylethyl N-[[1-(4-methyl-2-pyrimidinyl)-4-piperidinyl]methyl]carbamate, identified by its CAS number 1261232-28-3, is a chemical compound that belongs to the class of carbamates. This substance typically exhibits characteristics such as being a white to off-white solid or crystalline powder, which is soluble in organic solvents but may have limited solubility in water. Its molecular structure features a dimethyl group, a pyrimidine ring, and a piperidine moiety, contributing to its potential biological activity. The compound is often studied for its pharmacological properties, particularly in relation to its role as a potential therapeutic agent. It may interact with various biological targets, influencing processes such as enzyme activity or receptor binding. Safety and handling precautions are essential when working with this compound, as with many chemical substances, due to potential toxicity or environmental impact. Proper storage conditions and adherence to regulatory guidelines are also crucial for ensuring safe use in research or industrial applications.
Formula:C16H26N4O2
InChI:InChI=1S/C16H26N4O2/c1-12-5-8-17-14(19-12)20-9-6-13(7-10-20)11-18-15(21)22-16(2,3)4/h5,8,13H,6-7,9-11H2,1-4H3,(H,18,21)
InChI key:InChIKey=WARRKJGCEMMPEC-UHFFFAOYSA-N
SMILES:CC1=NC(=NC=C1)N2CCC(CNC(OC(C)(C)C)=O)CC2
Synonyms:- 1,1-Dimethylethyl N-[[1-(4-methyl-2-pyrimidinyl)-4-piperidinyl]methyl]carbamate
- Carbamic acid, N-[[1-(4-methyl-2-pyrimidinyl)-4-piperidinyl]methyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.