CymitQuimica logo

CAS 1261232-36-3

:

1,1-Dimethylethyl 4-[[(4-methyl-2-pyrimidinyl)oxy]methyl]-1-piperidinecarboxylate

Description:
1,1-Dimethylethyl 4-[[(4-methyl-2-pyrimidinyl)oxy]methyl]-1-piperidinecarboxylate, identified by its CAS number 1261232-36-3, is a chemical compound that features a complex structure incorporating a piperidine ring, a pyrimidine moiety, and an ester functional group. This compound is characterized by its potential biological activity, often explored in pharmaceutical research for its possible applications in drug development. The presence of the dimethyl group contributes to its steric properties, while the pyrimidine ring may enhance its interaction with biological targets. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it a subject of interest in medicinal chemistry. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods such as chromatography. Understanding its properties, including melting point, boiling point, and spectral data, would be essential for further applications and studies in various chemical and biological contexts.
Formula:C16H25N3O3
InChI:InChI=1S/C16H25N3O3/c1-12-5-8-17-14(18-12)21-11-13-6-9-19(10-7-13)15(20)22-16(2,3)4/h5,8,13H,6-7,9-11H2,1-4H3
InChI key:InChIKey=CCFXDIXHLVTCIV-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CCC(COC=2N=C(C)C=CN2)CC1
Synonyms:
  • 1-Piperidinecarboxylic acid, 4-[[(4-methyl-2-pyrimidinyl)oxy]methyl]-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 4-[[(4-methyl-2-pyrimidinyl)oxy]methyl]-1-piperidinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.