CAS 1261232-39-6

3-Piperidinamine, 1-(5-fluoro-2-pyrimidinyl)-N-methyl-, hydrochloride (1:1)

Description:

3-Piperidinamine, 1-(5-fluoro-2-pyrimidinyl)-N-methyl-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a 5-fluoro-2-pyrimidinyl group indicates that it has a fluorine atom substituted on the pyrimidine ring, contributing to its potential biological activity. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its pharmacokinetic properties. The N-methyl substitution on the piperidinamine moiety suggests that it may exhibit specific interactions with biological targets, potentially making it of interest in medicinal chemistry. Its molecular structure implies that it could be involved in various chemical reactions or serve as a precursor in the synthesis of more complex molecules. As with many nitrogen-containing compounds, it may exhibit basic properties, allowing it to form salts with acids. Overall, this compound's unique structural features may confer specific pharmacological properties, warranting further investigation in drug development contexts.

Formula: C₁₀H₁₅FN₄·ClH

InChI: InChI=1S/C10H15FN4.ClH/c1-12-9-3-2-4-15(7-9)10-13-5-8(11)6-14-10;/h5-6,9,12H,2-4,7H2,1H3;1H

InChI key: InChIKey=HUEXEUSCTSORAQ-UHFFFAOYSA-N

SMILES: N(C)C1CN(CCC1)C=2N=CC(F)=CN2.Cl

Synonyms:

• 3-Piperidinamine, 1-(5-fluoro-2-pyrimidinyl)-N-methyl-, hydrochloride (1:1)