CymitQuimica logo

CAS 1261232-68-1

:

2-Piperidinemethanamine, N,N-bis[(4-chlorophenyl)methyl]-, hydrochloride (1:1)

Description:
2-Piperidinemethanamine, N,N-bis[(4-chlorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential biological activity. The presence of two 4-chlorobenzyl groups enhances its lipophilicity, potentially influencing its interaction with biological membranes and receptors. As a hydrochloride salt, it is typically more soluble in water than its free base form, facilitating its use in various applications, including pharmaceuticals. The compound may exhibit properties such as being a potential ligand for certain receptors or enzymes, making it of interest in medicinal chemistry. Its structure suggests possible applications in drug development, particularly in areas targeting neurological or psychiatric conditions, given the piperidine moiety's prevalence in psychoactive compounds. Safety and handling precautions are essential, as with many chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to elucidate its specific pharmacological effects and mechanisms of action.
Formula:C20H24Cl2N2·ClH
InChI:InChI=1S/C20H24Cl2N2.ClH/c21-18-8-4-16(5-9-18)13-24(15-20-3-1-2-12-23-20)14-17-6-10-19(22)11-7-17;/h4-11,20,23H,1-3,12-15H2;1H
InChI key:InChIKey=BIWIVQPDQYZWSA-UHFFFAOYSA-N
SMILES:N(CC1=CC=C(Cl)C=C1)(CC2=CC=C(Cl)C=C2)CC3CCCCN3.Cl
Synonyms:
  • 2-Piperidinemethanamine, N,N-bis[(4-chlorophenyl)methyl]-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.