CAS 1261232-76-1
:1,1-Dimethylethyl 2-[[(3-methyl-2-pyrazinyl)oxy]methyl]-1-pyrrolidinecarboxylate
Description:
1,1-Dimethylethyl 2-[[(3-methyl-2-pyrazinyl)oxy]methyl]-1-pyrrolidinecarboxylate, identified by its CAS number 1261232-76-1, is a chemical compound that features a complex structure incorporating a pyrrolidine ring and a pyrazine moiety. The presence of the dimethyl group contributes to its steric properties, potentially influencing its reactivity and interactions with biological targets. This compound may exhibit specific pharmacological activities due to the functional groups present, which can facilitate interactions with enzymes or receptors. Its molecular structure suggests it could be lipophilic, affecting its solubility and permeability in biological systems. Additionally, the presence of the ether linkage (from the pyrazinyl group) may enhance its stability and influence its metabolic pathways. Overall, the characteristics of this compound make it a subject of interest in medicinal chemistry, particularly in the development of new therapeutic agents. However, detailed studies would be necessary to fully elucidate its properties and potential applications.
Formula:C15H23N3O3
InChI:InChI=1S/C15H23N3O3/c1-11-13(17-8-7-16-11)20-10-12-6-5-9-18(12)14(19)21-15(2,3)4/h7-8,12H,5-6,9-10H2,1-4H3
InChI key:InChIKey=QHHMWFBSUCMWRI-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1C(COC=2C(C)=NC=CN2)CCC1
Synonyms:- 1,1-Dimethylethyl 2-[[(3-methyl-2-pyrazinyl)oxy]methyl]-1-pyrrolidinecarboxylate
- 1-Pyrrolidinecarboxylic acid, 2-[[(3-methyl-2-pyrazinyl)oxy]methyl]-, 1,1-dimethylethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.