
CAS 1261232-80-7
:4-Piperidinemethanamine, N-[(4-chlorophenyl)methyl]-, hydrochloride (1:1)
Description:
4-Piperidinemethanamine, N-[(4-chlorophenyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its piperidine ring structure, which contributes to its basicity and potential as a pharmacological agent. The presence of the 4-chlorophenyl group enhances its lipophilicity, potentially influencing its ability to cross biological membranes. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including medicinal chemistry. This compound may exhibit properties such as being a potential ligand for neurotransmitter receptors, given its structural features. Its molecular interactions can be significant in drug design, particularly in the development of treatments for neurological disorders. Safety and handling precautions are essential, as with many amines and their derivatives, due to potential toxicity and reactivity. Overall, this compound's unique structure and properties make it of interest in both research and pharmaceutical contexts.
Formula:C13H19ClN2·ClH
InChI:InChI=1S/C13H19ClN2.ClH/c14-13-3-1-11(2-4-13)9-16-10-12-5-7-15-8-6-12;/h1-4,12,15-16H,5-10H2;1H
InChI key:InChIKey=HPHHRWKUAJURFD-UHFFFAOYSA-N
SMILES:C(NCC1CCNCC1)C2=CC=C(Cl)C=C2.Cl
Synonyms:- 4-Piperidinemethanamine, N-[(4-chlorophenyl)methyl]-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.