CAS 1261232-82-9

1-(5-Fluoro-2-pyrimidinyl)-3-piperidinemethanol

Description:

1-(5-Fluoro-2-pyrimidinyl)-3-piperidinemethanol is a chemical compound characterized by its unique structure, which includes a pyrimidine ring substituted with a fluorine atom and a piperidine moiety. The presence of the fluorine atom enhances the compound's lipophilicity and may influence its biological activity. The piperidine ring contributes to the compound's basicity and potential interactions with biological targets. This compound is often studied in medicinal chemistry for its potential therapeutic applications, particularly in the development of pharmaceuticals targeting various diseases. Its molecular structure suggests it may exhibit properties such as solubility in organic solvents and moderate stability under standard conditions. Additionally, the hydroxymethyl group attached to the piperidine may participate in hydrogen bonding, influencing its interaction with biological macromolecules. Overall, 1-(5-Fluoro-2-pyrimidinyl)-3-piperidinemethanol represents a class of compounds that could be valuable in drug discovery and development, particularly in the context of targeting specific receptors or enzymes.

Formula: C₁₀H₁₄FN₃O

InChI: InChI=1S/C10H14FN3O/c11-9-4-12-10(13-5-9)14-3-1-2-8(6-14)7-15/h4-5,8,15H,1-3,6-7H2

InChI key: InChIKey=CKBZVBRTGKJPNZ-UHFFFAOYSA-N

SMILES: C(O)C1CN(CCC1)C=2N=CC(F)=CN2

Synonyms:

• 3-Piperidinemethanol, 1-(5-fluoro-2-pyrimidinyl)-
• 1-(5-Fluoro-2-pyrimidinyl)-3-piperidinemethanol

3-Piperidinemethanol, 1-(5-fluoro-2-pyrimidinyl)-

CAS: 1261232-82-9

Formula: C₁₀H₁₄FN₃O

Purity: 95%

Molecular weight: 211.2361

Ref: IN-DA000ROK

[1-(5-Fluoro-pyrimidin-2-yl)-piperidin-3-yl]-methanol

CAS: 1261232-82-9

[1-(5-Fluoro-pyrimidin-2-yl)-piperidin-3-yl]-methanol

Purity: 95%

Molecular weight: 211.24g/mol

Ref: 54-PC408312