CAS 1261233-07-1

3-Pyrrolidinamine, N-[(2-fluorophenyl)methyl]-, hydrochloride (1:1), (3S)-

Description:

3-Pyrrolidinamine, N-[(2-fluorophenyl)methyl]-, hydrochloride (1:1), (3S)- is a chemical compound characterized by its pyrrolidine structure, which features a five-membered ring containing nitrogen. The presence of a 2-fluorophenyl group indicates that a fluorine atom is substituted on the phenyl ring, influencing the compound's electronic properties and potentially its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. The (3S)- designation refers to the specific stereochemistry of the compound, indicating that it has a particular spatial arrangement of atoms that can affect its interaction with biological targets. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its characteristics, including solubility, stability, and reactivity, are influenced by both its molecular structure and the presence of the hydrochloride moiety.

Formula: C₁₁H₁₅FN₂·ClH

InChI: InChI=1S/C11H15FN2.ClH/c12-11-4-2-1-3-9(11)7-14-10-5-6-13-8-10;/h1-4,10,13-14H,5-8H2;1H/t10-;/m0./s1

InChI key: InChIKey=RMAVTLAHGLIUIQ-PPHPATTJSA-N

SMILES: C(N[C@H]1CCNC1)C2=C(F)C=CC=C2.Cl

Synonyms:

• (3S)-N-[(2-Fluorophenyl)methyl]pyrrolidin-3-amine hydrochloride
• 3-Pyrrolidinamine, N-[(2-fluorophenyl)methyl]-, hydrochloride (1:1), (3S)-